C11H13N5O3S — CID 60983716
N-[4-(1H-1,2,4-triazol-5-ylmethylsulfamoyl)phenyl]acetamide (PubChem CID 60983716) has the molecular formula C11H13N5O3S and a molecular weight of 295.32 g/mol. Its IUPAC name is N-[4-(1H-1,2,4-triazol-5-ylmethylsulfamoyl)phenyl]acetamide.
| Compound Name | N-[4-(1H-1,2,4-triazol-5-ylmethylsulfamoyl)phenyl]acetamide |
|---|---|
| PubChem CID | 60983716 |
| Molecular Formula | C11H13N5O3S |
| Molecular Weight | 295.32 g/mol |
| Exact Mass | 295.07 |
| IUPAC Name | N-[4-(1H-1,2,4-triazol-5-ylmethylsulfamoyl)phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(S(=O)(=O)NCc2ncn[nH]2)cc1 |
| InChI | InChI=1S/C11H13N5O3S/c1-8(17)15-9-2-4-10(5-3-9)20(18,19)14-6-11-12-7-13-16-11/h2-5,7,14H,6H2,1H3,(H,15,17)(H,12,13,16) |
| InChIKey | GIGNUHITTLKZAE-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 116.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.32 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |