C16H17N3O6S2 — CID 71349024
N-[4-[(4-acetamidophenyl)sulfonylsulfamoyl]phenyl]acetamide (PubChem CID 71349024) has the molecular formula C16H17N3O6S2 and a molecular weight of 411.46 g/mol. Its IUPAC name is N-[4-[(4-acetamidophenyl)sulfonylsulfamoyl]phenyl]acetamide.
| Compound Name | N-[4-[(4-acetamidophenyl)sulfonylsulfamoyl]phenyl]acetamide |
|---|---|
| PubChem CID | 71349024 |
| Molecular Formula | C16H17N3O6S2 |
| Molecular Weight | 411.46 g/mol |
| Exact Mass | 411.06 |
| IUPAC Name | N-[4-[(4-acetamidophenyl)sulfonylsulfamoyl]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(S(=O)(=O)NS(=O)(=O)c2ccc(NC(C)=O)cc2)cc1 |
| InChI | InChI=1S/C16H17N3O6S2/c1-11(20)17-13-3-7-15(8-4-13)26(22,23)19-27(24,25)16-9-5-14(6-10-16)18-12(2)21/h3-10,19H,1-2H3,(H,17,20)(H,18,21) |
| InChIKey | DCUHIBWFVWJOGZ-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 138.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.46 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |