C9H10N2O4S — CID 117038027
N-(4-carbamoylsulfonylphenyl)acetamide (PubChem CID 117038027) has the molecular formula C9H10N2O4S and a molecular weight of 242.26 g/mol. Its IUPAC name is N-(4-carbamoylsulfonylphenyl)acetamide.
| Compound Name | N-(4-carbamoylsulfonylphenyl)acetamide |
|---|---|
| PubChem CID | 117038027 |
| Molecular Formula | C9H10N2O4S |
| Molecular Weight | 242.26 g/mol |
| Exact Mass | 242.04 |
| IUPAC Name | N-(4-carbamoylsulfonylphenyl)acetamide |
| SMILES | CC(=O)Nc1ccc(S(=O)(=O)C(N)=O)cc1 |
| InChI | InChI=1S/C9H10N2O4S/c1-6(12)11-7-2-4-8(5-3-7)16(14,15)9(10)13/h2-5H,1H3,(H2,10,13)(H,11,12) |
| InChIKey | QJYUNWNJKCIRGX-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 106.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.26 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|