C15H15N3O4S — CID 766030
4-acetamido-N-(4-sulfamoylphenyl)benzamide (PubChem CID 766030) has the molecular formula C15H15N3O4S and a molecular weight of 333.37 g/mol. Its IUPAC name is 4-acetamido-N-(4-sulfamoylphenyl)benzamide.
| Compound Name | 4-acetamido-N-(4-sulfamoylphenyl)benzamide |
|---|---|
| PubChem CID | 766030 |
| Molecular Formula | C15H15N3O4S |
| Molecular Weight | 333.37 g/mol |
| Exact Mass | 333.08 |
| IUPAC Name | 4-acetamido-N-(4-sulfamoylphenyl)benzamide |
| SMILES | CC(=O)Nc1ccc(C(=O)Nc2ccc(S(N)(=O)=O)cc2)cc1 |
| InChI | InChI=1S/C15H15N3O4S/c1-10(19)17-12-4-2-11(3-5-12)15(20)18-13-6-8-14(9-7-13)23(16,21)22/h2-9H,1H3,(H,17,19)(H,18,20)(H2,16,21,22) |
| InChIKey | JOXKNBJYSZIQHU-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 118.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.37 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |