C17H15N3O3S — CID 26718752
4-pyrrol-1-yl-N-(4-sulfamoylphenyl)benzamide (PubChem CID 26718752) has the molecular formula C17H15N3O3S and a molecular weight of 341.39 g/mol. Its IUPAC name is 4-pyrrol-1-yl-N-(4-sulfamoylphenyl)benzamide.
| Compound Name | 4-pyrrol-1-yl-N-(4-sulfamoylphenyl)benzamide |
|---|---|
| PubChem CID | 26718752 |
| Molecular Formula | C17H15N3O3S |
| Molecular Weight | 341.39 g/mol |
| Exact Mass | 341.08 |
| IUPAC Name | 4-pyrrol-1-yl-N-(4-sulfamoylphenyl)benzamide |
| SMILES | NS(=O)(=O)c1ccc(NC(=O)c2ccc(-n3cccc3)cc2)cc1 |
| InChI | InChI=1S/C17H15N3O3S/c18-24(22,23)16-9-5-14(6-10-16)19-17(21)13-3-7-15(8-4-13)20-11-1-2-12-20/h1-12H,(H,19,21)(H2,18,22,23) |
| InChIKey | JRPHMSNYGLFINN-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 94.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.39 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |