C20H18N2O3 — CID 110745346
N-[4-(1,3-dioxolan-2-yl)phenyl]-4-pyrrol-1-ylbenzamide (PubChem CID 110745346) has the molecular formula C20H18N2O3 and a molecular weight of 334.38 g/mol. Its IUPAC name is N-[4-(1,3-dioxolan-2-yl)phenyl]-4-pyrrol-1-ylbenzamide.
| Compound Name | N-[4-(1,3-dioxolan-2-yl)phenyl]-4-pyrrol-1-ylbenzamide |
|---|---|
| PubChem CID | 110745346 |
| Molecular Formula | C20H18N2O3 |
| Molecular Weight | 334.38 g/mol |
| Exact Mass | 334.13 |
| IUPAC Name | N-[4-(1,3-dioxolan-2-yl)phenyl]-4-pyrrol-1-ylbenzamide |
| SMILES | O=C(Nc1ccc(C2OCCO2)cc1)c1ccc(-n2cccc2)cc1 |
| InChI | InChI=1S/C20H18N2O3/c23-19(15-5-9-18(10-6-15)22-11-1-2-12-22)21-17-7-3-16(4-8-17)20-24-13-14-25-20/h1-12,20H,13-14H2,(H,21,23) |
| InChIKey | XFYRURCKYKSIGR-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.38 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |