C19H14N4O2 — CID 51090180
N-[4-(1,3,4-oxadiazol-2-yl)phenyl]-4-pyrrol-1-ylbenzamide (PubChem CID 51090180) has the molecular formula C19H14N4O2 and a molecular weight of 330.35 g/mol. Its IUPAC name is N-[4-(1,3,4-oxadiazol-2-yl)phenyl]-4-pyrrol-1-ylbenzamide.
| Compound Name | N-[4-(1,3,4-oxadiazol-2-yl)phenyl]-4-pyrrol-1-ylbenzamide |
|---|---|
| PubChem CID | 51090180 |
| Molecular Formula | C19H14N4O2 |
| Molecular Weight | 330.35 g/mol |
| Exact Mass | 330.11 |
| IUPAC Name | N-[4-(1,3,4-oxadiazol-2-yl)phenyl]-4-pyrrol-1-ylbenzamide |
| SMILES | O=C(Nc1ccc(-c2nnco2)cc1)c1ccc(-n2cccc2)cc1 |
| InChI | InChI=1S/C19H14N4O2/c24-18(14-5-9-17(10-6-14)23-11-1-2-12-23)21-16-7-3-15(4-8-16)19-22-20-13-25-19/h1-13H,(H,21,24) |
| InChIKey | BQOGEYHHJGEKRP-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 72.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.35 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |