C14H16N4O5S2 — CID 3595344
N-[4-[(4-sulfamoylanilino)sulfamoyl]phenyl]acetamide (PubChem CID 3595344) has the molecular formula C14H16N4O5S2 and a molecular weight of 384.44 g/mol. Its IUPAC name is N-[4-[(4-sulfamoylanilino)sulfamoyl]phenyl]acetamide.
| Compound Name | N-[4-[(4-sulfamoylanilino)sulfamoyl]phenyl]acetamide |
|---|---|
| PubChem CID | 3595344 |
| Molecular Formula | C14H16N4O5S2 |
| Molecular Weight | 384.44 g/mol |
| Exact Mass | 384.06 |
| IUPAC Name | N-[4-[(4-sulfamoylanilino)sulfamoyl]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(S(=O)(=O)NNc2ccc(S(N)(=O)=O)cc2)cc1 |
| InChI | InChI=1S/C14H16N4O5S2/c1-10(19)16-11-2-8-14(9-3-11)25(22,23)18-17-12-4-6-13(7-5-12)24(15,20)21/h2-9,17-18H,1H3,(H,16,19)(H2,15,20,21) |
| InChIKey | CYJCRDHGXBEJHL-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 147.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.44 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|