C8H10N4O4S — CID 86191002
1-carbamoyl-3-(4-sulfamoylphenyl)urea (PubChem CID 86191002) has the molecular formula C8H10N4O4S and a molecular weight of 258.26 g/mol. Its IUPAC name is 1-carbamoyl-3-(4-sulfamoylphenyl)urea.
| Compound Name | 1-carbamoyl-3-(4-sulfamoylphenyl)urea |
|---|---|
| PubChem CID | 86191002 |
| Molecular Formula | C8H10N4O4S |
| Molecular Weight | 258.26 g/mol |
| Exact Mass | 258.04 |
| IUPAC Name | 1-carbamoyl-3-(4-sulfamoylphenyl)urea |
| SMILES | NC(=O)NC(=O)Nc1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C8H10N4O4S/c9-7(13)12-8(14)11-5-1-3-6(4-2-5)17(10,15)16/h1-4H,(H2,10,15,16)(H4,9,11,12,13,14) |
| InChIKey | PSSMEKJLQMHUOA-UHFFFAOYSA-N |
| XLogP | -0.47 |
| TPSA | 144.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.26 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |