C9H11N3O4S — CID 146027008
1-(2-oxoethyl)-3-(4-sulfamoylphenyl)urea (PubChem CID 146027008) has the molecular formula C9H11N3O4S and a molecular weight of 257.27 g/mol. Its IUPAC name is 1-(2-oxoethyl)-3-(4-sulfamoylphenyl)urea.
| Compound Name | 1-(2-oxoethyl)-3-(4-sulfamoylphenyl)urea |
|---|---|
| PubChem CID | 146027008 |
| Molecular Formula | C9H11N3O4S |
| Molecular Weight | 257.27 g/mol |
| Exact Mass | 257.05 |
| IUPAC Name | 1-(2-oxoethyl)-3-(4-sulfamoylphenyl)urea |
| SMILES | NS(=O)(=O)c1ccc(NC(=O)NCC=O)cc1 |
| InChI | InChI=1S/C9H11N3O4S/c10-17(15,16)8-3-1-7(2-4-8)12-9(14)11-5-6-13/h1-4,6H,5H2,(H2,10,15,16)(H2,11,12,14) |
| InChIKey | SBASPVPVAHGNJG-UHFFFAOYSA-N |
| XLogP | -0.35 |
| TPSA | 118.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.27 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|