C12H15N3O5S — CID 67140737
2-[(4-sulfamoylphenyl)carbamoylamino]ethyl prop-2-enoate (PubChem CID 67140737) has the molecular formula C12H15N3O5S and a molecular weight of 313.34 g/mol. Its IUPAC name is 2-[(4-sulfamoylphenyl)carbamoylamino]ethyl prop-2-enoate.
| Compound Name | 2-[(4-sulfamoylphenyl)carbamoylamino]ethyl prop-2-enoate |
|---|---|
| PubChem CID | 67140737 |
| Molecular Formula | C12H15N3O5S |
| Molecular Weight | 313.34 g/mol |
| Exact Mass | 313.07 |
| IUPAC Name | 2-[(4-sulfamoylphenyl)carbamoylamino]ethyl prop-2-enoate |
| SMILES | C=CC(=O)OCCNC(=O)Nc1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C12H15N3O5S/c1-2-11(16)20-8-7-14-12(17)15-9-3-5-10(6-4-9)21(13,18)19/h2-6H,1,7-8H2,(H2,13,18,19)(H2,14,15,17) |
| InChIKey | BCQDNOISFZMNJO-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 127.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.34 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|