C26H30N4O8S — CID 59017101
2-[[4-[4-[2-(2-methylprop-2-enoyloxy)ethylcarbamoylamino]phenyl]sulfonylphenyl]carbamoylamino]ethyl 2-methylprop-2-enoate (PubChem CID 59017101) has the molecular formula C26H30N4O8S and a molecular weight of 558.61 g/mol. Its IUPAC name is 2-[[4-[4-[2-(2-methylprop-2-enoyloxy)ethylcarbamoylamino]phenyl]sulfonylphenyl]carbamoylamino]ethyl 2-methylprop-2-enoate.
| Compound Name | 2-[[4-[4-[2-(2-methylprop-2-enoyloxy)ethylcarbamoylamino]phenyl]sulfonylphenyl]carbamoylamino]ethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 59017101 |
| Molecular Formula | C26H30N4O8S |
| Molecular Weight | 558.61 g/mol |
| Exact Mass | 558.18 |
| IUPAC Name | 2-[[4-[4-[2-(2-methylprop-2-enoyloxy)ethylcarbamoylamino]phenyl]sulfonylphenyl]carbamoylamino]ethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCNC(=O)Nc1ccc(S(=O)(=O)c2ccc(NC(=O)NCCOC(=O)C(=C)C)cc2)cc1 |
| InChI | InChI=1S/C26H30N4O8S/c1-17(2)23(31)37-15-13-27-25(33)29-19-5-9-21(10-6-19)39(35,36)22-11-7-20(8-12-22)30-26(34)28-14-16-38-24(32)18(3)4/h5-12H,1,3,13-16H2,2,4H3,(H2,27,29,33)(H2,28,30,34) |
| InChIKey | UQWSGLWYWFKRMT-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 169.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.61 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|