C24H26O8S — CID 22239251
2-[4-[4-[2-(2-methylprop-2-enoyloxy)ethoxy]phenyl]sulfonylphenoxy]ethyl 2-methylprop-2-enoate (PubChem CID 22239251) has the molecular formula C24H26O8S and a molecular weight of 474.53 g/mol. Its IUPAC name is 2-[4-[4-[2-(2-methylprop-2-enoyloxy)ethoxy]phenyl]sulfonylphenoxy]ethyl 2-methylprop-2-enoate.
| Compound Name | 2-[4-[4-[2-(2-methylprop-2-enoyloxy)ethoxy]phenyl]sulfonylphenoxy]ethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 22239251 |
| Molecular Formula | C24H26O8S |
| Molecular Weight | 474.53 g/mol |
| Exact Mass | 474.13 |
| IUPAC Name | 2-[4-[4-[2-(2-methylprop-2-enoyloxy)ethoxy]phenyl]sulfonylphenoxy]ethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCOc1ccc(S(=O)(=O)c2ccc(OCCOC(=O)C(=C)C)cc2)cc1 |
| InChI | InChI=1S/C24H26O8S/c1-17(2)23(25)31-15-13-29-19-5-9-21(10-6-19)33(27,28)22-11-7-20(8-12-22)30-14-16-32-24(26)18(3)4/h5-12H,1,3,13-16H2,2,4H3 |
| InChIKey | HISXAVZUSLSHIK-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.53 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|