C25H30O5S — CID 54075363
2-[4-[2-[4-[(2R)-2-methylbutyl]sulfonylphenyl]ethenyl]phenoxy]ethyl 2-methylprop-2-enoate (PubChem CID 54075363) has the molecular formula C25H30O5S and a molecular weight of 442.58 g/mol. Its IUPAC name is 2-[4-[2-[4-[(2R)-2-methylbutyl]sulfonylphenyl]ethenyl]phenoxy]ethyl 2-methylprop-2-enoate.
| Compound Name | 2-[4-[2-[4-[(2R)-2-methylbutyl]sulfonylphenyl]ethenyl]phenoxy]ethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 54075363 |
| Molecular Formula | C25H30O5S |
| Molecular Weight | 442.58 g/mol |
| Exact Mass | 442.18 |
| IUPAC Name | 2-[4-[2-[4-[(2R)-2-methylbutyl]sulfonylphenyl]ethenyl]phenoxy]ethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCOc1ccc(C=Cc2ccc(S(=O)(=O)C[C@H](C)CC)cc2)cc1 |
| InChI | InChI=1S/C25H30O5S/c1-5-20(4)18-31(27,28)24-14-10-22(11-15-24)7-6-21-8-12-23(13-9-21)29-16-17-30-25(26)19(2)3/h6-15,20H,2,5,16-18H2,1,3-4H3/t20-/m1/s1 |
| InChIKey | MJHRHBOEBUVMPM-HXUWFJFHSA-N |
| XLogP | 5.17 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.58 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|