C23H36O7S — CID 172829854
2-[2-[2-[4-methyl-5-(4-methylphenyl)sulfonylpentoxy]ethoxy]ethoxy]ethyl 2-methylprop-2-enoate (PubChem CID 172829854) has the molecular formula C23H36O7S and a molecular weight of 456.60 g/mol. Its IUPAC name is 2-[2-[2-[4-methyl-5-(4-methylphenyl)sulfonylpentoxy]ethoxy]ethoxy]ethyl 2-methylprop-2-enoate.
| Compound Name | 2-[2-[2-[4-methyl-5-(4-methylphenyl)sulfonylpentoxy]ethoxy]ethoxy]ethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 172829854 |
| Molecular Formula | C23H36O7S |
| Molecular Weight | 456.60 g/mol |
| Exact Mass | 456.22 |
| IUPAC Name | 2-[2-[2-[4-methyl-5-(4-methylphenyl)sulfonylpentoxy]ethoxy]ethoxy]ethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCOCCOCCOCCCC(C)CS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C23H36O7S/c1-19(2)23(24)30-17-16-29-15-14-28-13-12-27-11-5-6-21(4)18-31(25,26)22-9-7-20(3)8-10-22/h7-10,21H,1,5-6,11-18H2,2-4H3 |
| InChIKey | VJEOONZAXCLVFB-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.60 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|