C17H24O6S — CID 118650319
2-(2-ethoxyethoxy)ethyl 2-[(4-methylphenyl)sulfonylmethyl]prop-2-enoate (PubChem CID 118650319) has the molecular formula C17H24O6S and a molecular weight of 356.44 g/mol. Its IUPAC name is 2-(2-ethoxyethoxy)ethyl 2-[(4-methylphenyl)sulfonylmethyl]prop-2-enoate.
| Compound Name | 2-(2-ethoxyethoxy)ethyl 2-[(4-methylphenyl)sulfonylmethyl]prop-2-enoate |
|---|---|
| PubChem CID | 118650319 |
| Molecular Formula | C17H24O6S |
| Molecular Weight | 356.44 g/mol |
| Exact Mass | 356.13 |
| IUPAC Name | 2-(2-ethoxyethoxy)ethyl 2-[(4-methylphenyl)sulfonylmethyl]prop-2-enoate |
| SMILES | C=C(CS(=O)(=O)c1ccc(C)cc1)C(=O)OCCOCCOCC |
| InChI | InChI=1S/C17H24O6S/c1-4-21-9-10-22-11-12-23-17(18)15(3)13-24(19,20)16-7-5-14(2)6-8-16/h5-8H,3-4,9-13H2,1-2H3 |
| InChIKey | JXJJKFXYYACDBU-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.44 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|