C20H22O8S2 — CID 58807069
bis[2-(4-methylphenyl)sulfonylethyl] oxalate (PubChem CID 58807069) has the molecular formula C20H22O8S2 and a molecular weight of 454.52 g/mol. Its IUPAC name is bis[2-(4-methylphenyl)sulfonylethyl] oxalate.
| Compound Name | bis[2-(4-methylphenyl)sulfonylethyl] oxalate |
|---|---|
| PubChem CID | 58807069 |
| Molecular Formula | C20H22O8S2 |
| Molecular Weight | 454.52 g/mol |
| Exact Mass | 454.08 |
| IUPAC Name | bis[2-(4-methylphenyl)sulfonylethyl] oxalate |
| SMILES | Cc1ccc(S(=O)(=O)CCOC(=O)C(=O)OCCS(=O)(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C20H22O8S2/c1-15-3-7-17(8-4-15)29(23,24)13-11-27-19(21)20(22)28-12-14-30(25,26)18-9-5-16(2)6-10-18/h3-10H,11-14H2,1-2H3 |
| InChIKey | VTIDCLDNUBRETP-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 120.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.52 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|