C26H36N2O8S2 — CID 58150321
2-(4-methylphenyl)sulfonylethyl N-[6-[2-(4-methylphenyl)sulfonylethoxycarbonylamino]hexyl]carbamate (PubChem CID 58150321) has the molecular formula C26H36N2O8S2 and a molecular weight of 568.71 g/mol. Its IUPAC name is 2-(4-methylphenyl)sulfonylethyl N-[6-[2-(4-methylphenyl)sulfonylethoxycarbonylamino]hexyl]carbamate.
| Compound Name | 2-(4-methylphenyl)sulfonylethyl N-[6-[2-(4-methylphenyl)sulfonylethoxycarbonylamino]hexyl]carbamate |
|---|---|
| PubChem CID | 58150321 |
| Molecular Formula | C26H36N2O8S2 |
| Molecular Weight | 568.71 g/mol |
| Exact Mass | 568.19 |
| IUPAC Name | 2-(4-methylphenyl)sulfonylethyl N-[6-[2-(4-methylphenyl)sulfonylethoxycarbonylamino]hexyl]carbamate |
| SMILES | Cc1ccc(S(=O)(=O)CCOC(=O)NCCCCCCNC(=O)OCCS(=O)(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C26H36N2O8S2/c1-21-7-11-23(12-8-21)37(31,32)19-17-35-25(29)27-15-5-3-4-6-16-28-26(30)36-18-20-38(33,34)24-13-9-22(2)10-14-24/h7-14H,3-6,15-20H2,1-2H3,(H,27,29)(H,28,30) |
| InChIKey | LFNBUEDANAHSRB-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 144.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.71 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|