C10H14O5S2 — CID 21412919
3-(4-methylphenyl)sulfonylpropane-1-sulfonic acid (PubChem CID 21412919) has the molecular formula C10H14O5S2 and a molecular weight of 278.35 g/mol. Its IUPAC name is 3-(4-methylphenyl)sulfonylpropane-1-sulfonic acid.
| Compound Name | 3-(4-methylphenyl)sulfonylpropane-1-sulfonic acid |
|---|---|
| PubChem CID | 21412919 |
| Molecular Formula | C10H14O5S2 |
| Molecular Weight | 278.35 g/mol |
| Exact Mass | 278.03 |
| IUPAC Name | 3-(4-methylphenyl)sulfonylpropane-1-sulfonic acid |
| SMILES | Cc1ccc(S(=O)(=O)CCCS(=O)(=O)O)cc1 |
| InChI | InChI=1S/C10H14O5S2/c1-9-3-5-10(6-4-9)16(11,12)7-2-8-17(13,14)15/h3-6H,2,7-8H2,1H3,(H,13,14,15) |
| InChIKey | WVVUEAXSUNDLGH-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 88.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.35 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|