C9H12O5S2 — CID 21412922
2-(4-methylphenyl)sulfonylethanesulfonic acid (PubChem CID 21412922) has the molecular formula C9H12O5S2 and a molecular weight of 264.32 g/mol. Its IUPAC name is 2-(4-methylphenyl)sulfonylethanesulfonic acid.
| Compound Name | 2-(4-methylphenyl)sulfonylethanesulfonic acid |
|---|---|
| PubChem CID | 21412922 |
| Molecular Formula | C9H12O5S2 |
| Molecular Weight | 264.32 g/mol |
| Exact Mass | 264.01 |
| IUPAC Name | 2-(4-methylphenyl)sulfonylethanesulfonic acid |
| SMILES | Cc1ccc(S(=O)(=O)CCS(=O)(=O)O)cc1 |
| InChI | InChI=1S/C9H12O5S2/c1-8-2-4-9(5-3-8)15(10,11)6-7-16(12,13)14/h2-5H,6-7H2,1H3,(H,12,13,14) |
| InChIKey | FURGCBYUMJDNSQ-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 88.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.32 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|