C10H13NO4S — CID 167574068
N-hydroxy-3-(4-methylphenyl)sulfonylpropanamide (PubChem CID 167574068) has the molecular formula C10H13NO4S and a molecular weight of 243.28 g/mol. Its IUPAC name is N-hydroxy-3-(4-methylphenyl)sulfonylpropanamide.
| Compound Name | N-hydroxy-3-(4-methylphenyl)sulfonylpropanamide |
|---|---|
| PubChem CID | 167574068 |
| Molecular Formula | C10H13NO4S |
| Molecular Weight | 243.28 g/mol |
| Exact Mass | 243.06 |
| IUPAC Name | N-hydroxy-3-(4-methylphenyl)sulfonylpropanamide |
| SMILES | Cc1ccc(S(=O)(=O)CCC(=O)NO)cc1 |
| InChI | InChI=1S/C10H13NO4S/c1-8-2-4-9(5-3-8)16(14,15)7-6-10(12)11-13/h2-5,13H,6-7H2,1H3,(H,11,12) |
| InChIKey | GHDMHUDRKGAQPK-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.28 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|