C21H33N3O11S — CID 58340322
3-[2,2-bis[[3-(hydroxyamino)-3-oxopropoxy]methyl]-3-(4-methylphenyl)sulfonylpropoxy]-N-hydroxypropanamide (PubChem CID 58340322) has the molecular formula C21H33N3O11S and a molecular weight of 535.57 g/mol. Its IUPAC name is 3-[2,2-bis[[3-(hydroxyamino)-3-oxopropoxy]methyl]-3-(4-methylphenyl)sulfonylpropoxy]-N-hydroxypropanamide.
| Compound Name | 3-[2,2-bis[[3-(hydroxyamino)-3-oxopropoxy]methyl]-3-(4-methylphenyl)sulfonylpropoxy]-N-hydroxypropanamide |
|---|---|
| PubChem CID | 58340322 |
| Molecular Formula | C21H33N3O11S |
| Molecular Weight | 535.57 g/mol |
| Exact Mass | 535.18 |
| IUPAC Name | 3-[2,2-bis[[3-(hydroxyamino)-3-oxopropoxy]methyl]-3-(4-methylphenyl)sulfonylpropoxy]-N-hydroxypropanamide |
| SMILES | Cc1ccc(S(=O)(=O)CC(COCCC(=O)NO)(COCCC(=O)NO)COCCC(=O)NO)cc1 |
| InChI | InChI=1S/C21H33N3O11S/c1-16-2-4-17(5-3-16)36(31,32)15-21(12-33-9-6-18(25)22-28,13-34-10-7-19(26)23-29)14-35-11-8-20(27)24-30/h2-5,28-30H,6-15H2,1H3,(H,22,25)(H,23,26)(H,24,27) |
| InChIKey | XBAWNTINOMNOJV-UHFFFAOYSA-N |
| XLogP | -0.51 |
| TPSA | 209.82 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 36 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.57 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|