C22H33N3O10 — CID 58340327
3-[2,2-bis[[3-(hydroxyamino)-3-oxopropoxy]methyl]-4-(4-methylphenyl)-4-oxobutoxy]-N-hydroxypropanamide (PubChem CID 58340327) has the molecular formula C22H33N3O10 and a molecular weight of 499.52 g/mol. Its IUPAC name is 3-[2,2-bis[[3-(hydroxyamino)-3-oxopropoxy]methyl]-4-(4-methylphenyl)-4-oxobutoxy]-N-hydroxypropanamide.
| Compound Name | 3-[2,2-bis[[3-(hydroxyamino)-3-oxopropoxy]methyl]-4-(4-methylphenyl)-4-oxobutoxy]-N-hydroxypropanamide |
|---|---|
| PubChem CID | 58340327 |
| Molecular Formula | C22H33N3O10 |
| Molecular Weight | 499.52 g/mol |
| Exact Mass | 499.22 |
| IUPAC Name | 3-[2,2-bis[[3-(hydroxyamino)-3-oxopropoxy]methyl]-4-(4-methylphenyl)-4-oxobutoxy]-N-hydroxypropanamide |
| SMILES | Cc1ccc(C(=O)CC(COCCC(=O)NO)(COCCC(=O)NO)COCCC(=O)NO)cc1 |
| InChI | InChI=1S/C22H33N3O10/c1-16-2-4-17(5-3-16)18(26)12-22(13-33-9-6-19(27)23-30,14-34-10-7-20(28)24-31)15-35-11-8-21(29)25-32/h2-5,30-32H,6-15H2,1H3,(H,23,27)(H,24,28)(H,25,29) |
| InChIKey | OQEYHJNDWMFPNY-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 192.75 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.52 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|