About methyl 4-methylbenzoate
methyl 4-methylbenzoate (PubChem CID 91113291) has the molecular formula C18H20O4
and a molecular weight of 300.35 g/mol. Its IUPAC name is methyl 4-methylbenzoate.
Molecular Properties
| Compound Name | methyl 4-methylbenzoate |
| PubChem CID | 91113291 |
| Molecular Formula | C18H20O4 |
| Molecular Weight | 300.35 g/mol |
| Exact Mass | 300.14 |
| IUPAC Name | methyl 4-methylbenzoate |
| SMILES | COC(=O)c1ccc(C)cc1.COC(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/2C9H10O2/c2*1-7-3-5-8(6-4-7)9(10)11-2/h2*3-6H,1-2H3 |
| InChIKey | DWEYPCOAMRQKIT-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.35 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl 4-methylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-methylbenzoate?
The IUPAC name of methyl 4-methylbenzoate (CID 91113291) is methyl 4-methylbenzoate.
What is the SMILES notation for methyl 4-methylbenzoate?
The canonical SMILES for methyl 4-methylbenzoate is COC(=O)c1ccc(C)cc1.COC(=O)c1ccc(C)cc1.
What is the InChIKey of methyl 4-methylbenzoate?
The InChIKey is DWEYPCOAMRQKIT-UHFFFAOYSA-N. The full InChI is InChI=1S/2C9H10O2/c2*1-7-3-5-8(6-4-7)9(10)11-2/h2*3-6H,1-2H3.
What are the key properties of methyl 4-methylbenzoate?
methyl 4-methylbenzoate has a molecular weight of 300.35 g/mol, XLogP of 3.56, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-methylbenzoate is sourced from PubChem (CID 91113291), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).