C22H33NO3 — CID 143418770
N,4-dimethylbenzamide;ethane;methyl 4-methylbenzoate (PubChem CID 143418770) has the molecular formula C22H33NO3 and a molecular weight of 359.51 g/mol. Its IUPAC name is N,4-dimethylbenzamide;ethane;methyl 4-methylbenzoate.
| Compound Name | N,4-dimethylbenzamide;ethane;methyl 4-methylbenzoate |
|---|---|
| PubChem CID | 143418770 |
| Molecular Formula | C22H33NO3 |
| Molecular Weight | 359.51 g/mol |
| Exact Mass | 359.25 |
| IUPAC Name | N,4-dimethylbenzamide;ethane;methyl 4-methylbenzoate |
| SMILES | CC.CC.CNC(=O)c1ccc(C)cc1.COC(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C9H11NO.C9H10O2.2C2H6/c1-7-3-5-8(6-4-7)9(11)10-2;1-7-3-5-8(6-4-7)9(10)11-2;2*1-2/h3-6H,1-2H3,(H,10,11);3-6H,1-2H3;2*1-2H3 |
| InChIKey | CSJMHGDKKQEZOS-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.51 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |