C20H31NO — CID 143677670
N,4-dimethylbenzamide;ethane;toluene (PubChem CID 143677670) has the molecular formula C20H31NO and a molecular weight of 301.47 g/mol. Its IUPAC name is N,4-dimethylbenzamide;ethane;toluene.
| Compound Name | N,4-dimethylbenzamide;ethane;toluene |
|---|---|
| PubChem CID | 143677670 |
| Molecular Formula | C20H31NO |
| Molecular Weight | 301.47 g/mol |
| Exact Mass | 301.24 |
| IUPAC Name | N,4-dimethylbenzamide;ethane;toluene |
| SMILES | CC.CC.CNC(=O)c1ccc(C)cc1.Cc1ccccc1 |
| InChI | InChI=1S/C9H11NO.C7H8.2C2H6/c1-7-3-5-8(6-4-7)9(11)10-2;1-7-5-3-2-4-6-7;2*1-2/h3-6H,1-2H3,(H,10,11);2-6H,1H3;2*1-2H3 |
| InChIKey | WKWNXFNAPYAABJ-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.47 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |