About N-methylbenzamide;sulfuryl dichloride
N-methylbenzamide;sulfuryl dichloride (PubChem CID 158851255) has the molecular formula C8H9Cl2NO3S
and a molecular weight of 270.14 g/mol. Its IUPAC name is N-methylbenzamide;sulfuryl dichloride.
Molecular Properties
| Compound Name | N-methylbenzamide;sulfuryl dichloride |
| PubChem CID | 158851255 |
| Molecular Formula | C8H9Cl2NO3S |
| Molecular Weight | 270.14 g/mol |
| Exact Mass | 268.97 |
| IUPAC Name | N-methylbenzamide;sulfuryl dichloride |
| SMILES | CNC(=O)c1ccccc1.O=S(=O)(Cl)Cl |
| InChI | InChI=1S/C8H9NO.Cl2O2S/c1-9-8(10)7-5-3-2-4-6-7;1-5(2,3)4/h2-6H,1H3,(H,9,10); |
| InChIKey | IZMAGVCLNIMEDL-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.14 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-methylbenzamide;sulfuryl dichloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methylbenzamide;sulfuryl dichloride?
The IUPAC name of N-methylbenzamide;sulfuryl dichloride (CID 158851255) is N-methylbenzamide;sulfuryl dichloride.
What is the SMILES notation for N-methylbenzamide;sulfuryl dichloride?
The canonical SMILES for N-methylbenzamide;sulfuryl dichloride is CNC(=O)c1ccccc1.O=S(=O)(Cl)Cl.
What is the InChIKey of N-methylbenzamide;sulfuryl dichloride?
The InChIKey is IZMAGVCLNIMEDL-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9NO.Cl2O2S/c1-9-8(10)7-5-3-2-4-6-7;1-5(2,3)4/h2-6H,1H3,(H,9,10);.
What are the key properties of N-methylbenzamide;sulfuryl dichloride?
N-methylbenzamide;sulfuryl dichloride has a molecular weight of 270.14 g/mol, XLogP of 1.75, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-methylbenzamide;sulfuryl dichloride is sourced from PubChem (CID 158851255), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).