About ethane;N-methylbenzamide;2-methylpropane
ethane;N-methylbenzamide;2-methylpropane (PubChem CID 161462553) has the molecular formula C16H31NO
and a molecular weight of 253.43 g/mol. Its IUPAC name is ethane;N-methylbenzamide;2-methylpropane.
Molecular Properties
| Compound Name | ethane;N-methylbenzamide;2-methylpropane |
| PubChem CID | 161462553 |
| Molecular Formula | C16H31NO |
| Molecular Weight | 253.43 g/mol |
| Exact Mass | 253.24 |
| IUPAC Name | ethane;N-methylbenzamide;2-methylpropane |
| SMILES | CC.CC.CC(C)C.CNC(=O)c1ccccc1 |
| InChI | InChI=1S/C8H9NO.C4H10.2C2H6/c1-9-8(10)7-5-3-2-4-6-7;1-4(2)3;2*1-2/h2-6H,1H3,(H,9,10);4H,1-3H3;2*1-2H3 |
| InChIKey | WBZVDNFSNSSXEV-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.43 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze ethane;N-methylbenzamide;2-methylpropane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;N-methylbenzamide;2-methylpropane?
The IUPAC name of ethane;N-methylbenzamide;2-methylpropane (CID 161462553) is ethane;N-methylbenzamide;2-methylpropane.
What is the SMILES notation for ethane;N-methylbenzamide;2-methylpropane?
The canonical SMILES for ethane;N-methylbenzamide;2-methylpropane is CC.CC.CC(C)C.CNC(=O)c1ccccc1.
What is the InChIKey of ethane;N-methylbenzamide;2-methylpropane?
The InChIKey is WBZVDNFSNSSXEV-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9NO.C4H10.2C2H6/c1-9-8(10)7-5-3-2-4-6-7;1-4(2)3;2*1-2/h2-6H,1H3,(H,9,10);4H,1-3H3;2*1-2H3.
What are the key properties of ethane;N-methylbenzamide;2-methylpropane?
ethane;N-methylbenzamide;2-methylpropane has a molecular weight of 253.43 g/mol, XLogP of 4.76, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;N-methylbenzamide;2-methylpropane is sourced from PubChem (CID 161462553), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).