About ethoxy(methyl)silane;bis(N-methylbenzamide)
ethoxy(methyl)silane;bis(N-methylbenzamide) (PubChem CID 161279308) has the molecular formula C19H28N2O3Si
and a molecular weight of 360.53 g/mol. Its IUPAC name is ethoxy(methyl)silane;bis(N-methylbenzamide).
Molecular Properties
| Compound Name | ethoxy(methyl)silane;bis(N-methylbenzamide) |
| PubChem CID | 161279308 |
| Molecular Formula | C19H28N2O3Si |
| Molecular Weight | 360.53 g/mol |
| Exact Mass | 360.19 |
| IUPAC Name | ethoxy(methyl)silane;bis(N-methylbenzamide) |
| SMILES | CCO[SiH2]C.CNC(=O)c1ccccc1.CNC(=O)c1ccccc1 |
| InChI | InChI=1S/2C8H9NO.C3H10OSi/c2*1-9-8(10)7-5-3-2-4-6-7;1-3-4-5-2/h2*2-6H,1H3,(H,9,10);3,5H2,1-2H3 |
| InChIKey | VEWDOYADCWFQGN-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 360.53 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze ethoxy(methyl)silane;bis(N-methylbenzamide) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethoxy(methyl)silane;bis(N-methylbenzamide)?
The IUPAC name of ethoxy(methyl)silane;bis(N-methylbenzamide) (CID 161279308) is ethoxy(methyl)silane;bis(N-methylbenzamide).
What is the SMILES notation for ethoxy(methyl)silane;bis(N-methylbenzamide)?
The canonical SMILES for ethoxy(methyl)silane;bis(N-methylbenzamide) is CCO[SiH2]C.CNC(=O)c1ccccc1.CNC(=O)c1ccccc1.
What is the InChIKey of ethoxy(methyl)silane;bis(N-methylbenzamide)?
The InChIKey is VEWDOYADCWFQGN-UHFFFAOYSA-N. The full InChI is InChI=1S/2C8H9NO.C3H10OSi/c2*1-9-8(10)7-5-3-2-4-6-7;1-3-4-5-2/h2*2-6H,1H3,(H,9,10);3,5H2,1-2H3.
What are the key properties of ethoxy(methyl)silane;bis(N-methylbenzamide)?
ethoxy(methyl)silane;bis(N-methylbenzamide) has a molecular weight of 360.53 g/mol, XLogP of 2.25, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethoxy(methyl)silane;bis(N-methylbenzamide) is sourced from PubChem (CID 161279308), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).