About lithium;hydride;N-methylbenzamide
lithium;hydride;N-methylbenzamide (PubChem CID 173287348) has the molecular formula C8H10LiNO
and a molecular weight of 143.11 g/mol. Its IUPAC name is lithium;hydride;N-methylbenzamide.
Molecular Properties
| Compound Name | lithium;hydride;N-methylbenzamide |
| PubChem CID | 173287348 |
| Molecular Formula | C8H10LiNO |
| Molecular Weight | 143.11 g/mol |
| Exact Mass | 143.09 |
| IUPAC Name | lithium;hydride;N-methylbenzamide |
| SMILES | CNC(=O)c1ccccc1.[H-].[Li+] |
| InChI | InChI=1S/C8H9NO.Li.H/c1-9-8(10)7-5-3-2-4-6-7;;/h2-6H,1H3,(H,9,10);;/q;+1;-1 |
| InChIKey | OONIUCXMPJUGON-UHFFFAOYSA-N |
| XLogP | -1.84 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 143.11 |
| LogP ≤ 5 | -1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze lithium;hydride;N-methylbenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of lithium;hydride;N-methylbenzamide?
The IUPAC name of lithium;hydride;N-methylbenzamide (CID 173287348) is lithium;hydride;N-methylbenzamide.
What is the SMILES notation for lithium;hydride;N-methylbenzamide?
The canonical SMILES for lithium;hydride;N-methylbenzamide is CNC(=O)c1ccccc1.[H-].[Li+].
What is the InChIKey of lithium;hydride;N-methylbenzamide?
The InChIKey is OONIUCXMPJUGON-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9NO.Li.H/c1-9-8(10)7-5-3-2-4-6-7;;/h2-6H,1H3,(H,9,10);;/q;+1;-1.
What are the key properties of lithium;hydride;N-methylbenzamide?
lithium;hydride;N-methylbenzamide has a molecular weight of 143.11 g/mol, XLogP of -1.84, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for lithium;hydride;N-methylbenzamide is sourced from PubChem (CID 173287348), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).