About calcium;hydride;N-hydroxybenzamide
calcium;hydride;N-hydroxybenzamide (PubChem CID 175061214) has the molecular formula C7H9CaNO2
and a molecular weight of 179.23 g/mol. Its IUPAC name is calcium;hydride;N-hydroxybenzamide.
Molecular Properties
| Compound Name | calcium;hydride;N-hydroxybenzamide |
| PubChem CID | 175061214 |
| Molecular Formula | C7H9CaNO2 |
| Molecular Weight | 179.23 g/mol |
| Exact Mass | 179.03 |
| IUPAC Name | calcium;hydride;N-hydroxybenzamide |
| SMILES | O=C(NO)c1ccccc1.[Ca+2].[H-].[H-] |
| InChI | InChI=1S/C7H7NO2.Ca.2H/c9-7(8-10)6-4-2-1-3-5-6;;;/h1-5,10H,(H,8,9);;;/q;+2;2*-1 |
| InChIKey | JXDIETRZPLQKQL-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.23 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze calcium;hydride;N-hydroxybenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of calcium;hydride;N-hydroxybenzamide?
The IUPAC name of calcium;hydride;N-hydroxybenzamide (CID 175061214) is calcium;hydride;N-hydroxybenzamide.
What is the SMILES notation for calcium;hydride;N-hydroxybenzamide?
The canonical SMILES for calcium;hydride;N-hydroxybenzamide is O=C(NO)c1ccccc1.[Ca+2].[H-].[H-].
What is the InChIKey of calcium;hydride;N-hydroxybenzamide?
The InChIKey is JXDIETRZPLQKQL-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7NO2.Ca.2H/c9-7(8-10)6-4-2-1-3-5-6;;;/h1-5,10H,(H,8,9);;;/q;+2;2*-1.
What are the key properties of calcium;hydride;N-hydroxybenzamide?
calcium;hydride;N-hydroxybenzamide has a molecular weight of 179.23 g/mol, XLogP of 0.65, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for calcium;hydride;N-hydroxybenzamide is sourced from PubChem (CID 175061214), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).