C21H18N4O3 — CID 91211036
N',N'-dibenzamidobenzohydrazide (PubChem CID 91211036) has the molecular formula C21H18N4O3 and a molecular weight of 374.40 g/mol. Its IUPAC name is N',N'-dibenzamidobenzohydrazide.
| Compound Name | N',N'-dibenzamidobenzohydrazide |
|---|---|
| PubChem CID | 91211036 |
| Molecular Formula | C21H18N4O3 |
| Molecular Weight | 374.40 g/mol |
| Exact Mass | 374.14 |
| IUPAC Name | N',N'-dibenzamidobenzohydrazide |
| SMILES | O=C(NN(NC(=O)c1ccccc1)NC(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H18N4O3/c26-19(16-10-4-1-5-11-16)22-25(23-20(27)17-12-6-2-7-13-17)24-21(28)18-14-8-3-9-15-18/h1-15H,(H,22,26)(H,23,27)(H,24,28) |
| InChIKey | QEMBJGASRJXRAN-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 90.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.40 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|