About N'-(4-anilinophenyl)-N'-phenylbenzohydrazide
N'-(4-anilinophenyl)-N'-phenylbenzohydrazide (PubChem CID 21276074) has the molecular formula C25H21N3O
and a molecular weight of 379.46 g/mol. Its IUPAC name is N'-(4-anilinophenyl)-N'-phenylbenzohydrazide.
Molecular Properties
| Compound Name | N'-(4-anilinophenyl)-N'-phenylbenzohydrazide |
| PubChem CID | 21276074 |
| Molecular Formula | C25H21N3O |
| Molecular Weight | 379.46 g/mol |
| Exact Mass | 379.17 |
| IUPAC Name | N'-(4-anilinophenyl)-N'-phenylbenzohydrazide |
| SMILES | O=C(NN(c1ccccc1)c1ccc(Nc2ccccc2)cc1)c1ccccc1 |
| InChI | InChI=1S/C25H21N3O/c29-25(20-10-4-1-5-11-20)27-28(23-14-8-3-9-15-23)24-18-16-22(17-19-24)26-21-12-6-2-7-13-21/h1-19,26H,(H,27,29) |
| InChIKey | BGHFRUPPMINSNY-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 379.46 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N'-(4-anilinophenyl)-N'-phenylbenzohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-(4-anilinophenyl)-N'-phenylbenzohydrazide?
The IUPAC name of N'-(4-anilinophenyl)-N'-phenylbenzohydrazide (CID 21276074) is N'-(4-anilinophenyl)-N'-phenylbenzohydrazide.
What is the SMILES notation for N'-(4-anilinophenyl)-N'-phenylbenzohydrazide?
The canonical SMILES for N'-(4-anilinophenyl)-N'-phenylbenzohydrazide is O=C(NN(c1ccccc1)c1ccc(Nc2ccccc2)cc1)c1ccccc1.
What is the InChIKey of N'-(4-anilinophenyl)-N'-phenylbenzohydrazide?
The InChIKey is BGHFRUPPMINSNY-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H21N3O/c29-25(20-10-4-1-5-11-20)27-28(23-14-8-3-9-15-23)24-18-16-22(17-19-24)26-21-12-6-2-7-13-21/h1-19,26H,(H,27,29).
What are the key properties of N'-(4-anilinophenyl)-N'-phenylbenzohydrazide?
N'-(4-anilinophenyl)-N'-phenylbenzohydrazide has a molecular weight of 379.46 g/mol, XLogP of 5.91, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N'-(4-anilinophenyl)-N'-phenylbenzohydrazide is sourced from PubChem (CID 21276074), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).