C19H18N2O3 — CID 160785821
carbonic acid;1,1,2-triphenylhydrazine (PubChem CID 160785821) has the molecular formula C19H18N2O3 and a molecular weight of 322.36 g/mol. Its IUPAC name is carbonic acid;1,1,2-triphenylhydrazine.
| Compound Name | carbonic acid;1,1,2-triphenylhydrazine |
|---|---|
| PubChem CID | 160785821 |
| Molecular Formula | C19H18N2O3 |
| Molecular Weight | 322.36 g/mol |
| Exact Mass | 322.13 |
| IUPAC Name | carbonic acid;1,1,2-triphenylhydrazine |
| SMILES | O=C(O)O.c1ccc(NN(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C18H16N2.CH2O3/c1-4-10-16(11-5-1)19-20(17-12-6-2-7-13-17)18-14-8-3-9-15-18;2-1(3)4/h1-15,19H;(H2,2,3,4) |
| InChIKey | SBERPFUQWCDHFN-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 72.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.36 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|