About mercury;(N-phenylanilino)urea
mercury;(N-phenylanilino)urea (PubChem CID 175145706) has the molecular formula C13H13HgN3O
and a molecular weight of 427.86 g/mol. Its IUPAC name is mercury;(N-phenylanilino)urea.
Molecular Properties
| Compound Name | mercury;(N-phenylanilino)urea |
| PubChem CID | 175145706 |
| Molecular Formula | C13H13HgN3O |
| Molecular Weight | 427.86 g/mol |
| Exact Mass | 429.08 |
| IUPAC Name | mercury;(N-phenylanilino)urea |
| SMILES | NC(=O)NN(c1ccccc1)c1ccccc1.[Hg] |
| InChI | InChI=1S/C13H13N3O.Hg/c14-13(17)15-16(11-7-3-1-4-8-11)12-9-5-2-6-10-12;/h1-10H,(H3,14,15,17); |
| InChIKey | AUMKEEYJQLKSCY-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 427.86 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze mercury;(N-phenylanilino)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of mercury;(N-phenylanilino)urea?
The IUPAC name of mercury;(N-phenylanilino)urea (CID 175145706) is mercury;(N-phenylanilino)urea.
What is the SMILES notation for mercury;(N-phenylanilino)urea?
The canonical SMILES for mercury;(N-phenylanilino)urea is NC(=O)NN(c1ccccc1)c1ccccc1.[Hg].
What is the InChIKey of mercury;(N-phenylanilino)urea?
The InChIKey is AUMKEEYJQLKSCY-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13N3O.Hg/c14-13(17)15-16(11-7-3-1-4-8-11)12-9-5-2-6-10-12;/h1-10H,(H3,14,15,17);.
What are the key properties of mercury;(N-phenylanilino)urea?
mercury;(N-phenylanilino)urea has a molecular weight of 427.86 g/mol, XLogP of 2.41, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for mercury;(N-phenylanilino)urea is sourced from PubChem (CID 175145706), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).