C34H38N4O2 — CID 175049225
1-N',1-N',10-N',10-N'-tetraphenyldecanedihydrazide (PubChem CID 175049225) has the molecular formula C34H38N4O2 and a molecular weight of 534.70 g/mol. Its IUPAC name is 1-N',1-N',10-N',10-N'-tetraphenyldecanedihydrazide.
| Compound Name | 1-N',1-N',10-N',10-N'-tetraphenyldecanedihydrazide |
|---|---|
| PubChem CID | 175049225 |
| Molecular Formula | C34H38N4O2 |
| Molecular Weight | 534.70 g/mol |
| Exact Mass | 534.30 |
| IUPAC Name | 1-N',1-N',10-N',10-N'-tetraphenyldecanedihydrazide |
| SMILES | O=C(CCCCCCCCC(=O)NN(c1ccccc1)c1ccccc1)NN(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C34H38N4O2/c39-33(35-37(29-19-9-5-10-20-29)30-21-11-6-12-22-30)27-17-3-1-2-4-18-28-34(40)36-38(31-23-13-7-14-24-31)32-25-15-8-16-26-32/h5-16,19-26H,1-4,17-18,27-28H2,(H,35,39)(H,36,40) |
| InChIKey | IWGGSODUFVTGFA-UHFFFAOYSA-N |
| XLogP | 7.85 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.70 |
| LogP ≤ 5 | 7.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|