C24H28N2O7 — CID 140973372
10-[2,2-bis(2-hydroxybenzoyl)hydrazinyl]-10-oxodecanoic acid (PubChem CID 140973372) has the molecular formula C24H28N2O7 and a molecular weight of 456.50 g/mol. Its IUPAC name is 10-[2,2-bis(2-hydroxybenzoyl)hydrazinyl]-10-oxodecanoic acid.
| Compound Name | 10-[2,2-bis(2-hydroxybenzoyl)hydrazinyl]-10-oxodecanoic acid |
|---|---|
| PubChem CID | 140973372 |
| Molecular Formula | C24H28N2O7 |
| Molecular Weight | 456.50 g/mol |
| Exact Mass | 456.19 |
| IUPAC Name | 10-[2,2-bis(2-hydroxybenzoyl)hydrazinyl]-10-oxodecanoic acid |
| SMILES | O=C(O)CCCCCCCCC(=O)NN(C(=O)c1ccccc1O)C(=O)c1ccccc1O |
| InChI | InChI=1S/C24H28N2O7/c27-19-13-9-7-11-17(19)23(32)26(24(33)18-12-8-10-14-20(18)28)25-21(29)15-5-3-1-2-4-6-16-22(30)31/h7-14,27-28H,1-6,15-16H2,(H,25,29)(H,30,31) |
| InChIKey | WIPFLHQTDNGPBQ-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 144.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.50 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|