C24H30N4O4 — CID 175365921
10-N',10-N'-dibenzoyldecanedihydrazide (PubChem CID 175365921) has the molecular formula C24H30N4O4 and a molecular weight of 438.53 g/mol. Its IUPAC name is 10-N',10-N'-dibenzoyldecanedihydrazide.
| Compound Name | 10-N',10-N'-dibenzoyldecanedihydrazide |
|---|---|
| PubChem CID | 175365921 |
| Molecular Formula | C24H30N4O4 |
| Molecular Weight | 438.53 g/mol |
| Exact Mass | 438.23 |
| IUPAC Name | 10-N',10-N'-dibenzoyldecanedihydrazide |
| SMILES | NNC(=O)CCCCCCCCC(=O)NN(C(=O)c1ccccc1)C(=O)c1ccccc1 |
| InChI | InChI=1S/C24H30N4O4/c25-26-21(29)17-11-3-1-2-4-12-18-22(30)27-28(23(31)19-13-7-5-8-14-19)24(32)20-15-9-6-10-16-20/h5-10,13-16H,1-4,11-12,17-18,25H2,(H,26,29)(H,27,30) |
| InChIKey | XFGZRQKFYKAXJN-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 121.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.53 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|