10-hydrazinyl-10-oxodecanoic acid

C20H40N4O6 — CID 175271493

IUPAC10-hydrazinyl-10-oxodecanoic acid
SMILESNNC(=O)CCCCCCCCC(=O)O.NNC(=O)CCCCCCCCC(=O)O
InChIInChI=1S/2C10H20N2O3/c2*11-12-9(13)7-5-3-1-2-4-6-8-10(14)15/h2*1-8,11H2,(H,12,13)(H,14,15)
InChIKeyMGABPWLVFWWMRX-UHFFFAOYSA-N
MW432.56 g/mol
LogP2.36
Rot. Bonds18

About 10-hydrazinyl-10-oxodecanoic acid

10-hydrazinyl-10-oxodecanoic acid (PubChem CID 175271493) has the molecular formula C20H40N4O6 and a molecular weight of 432.56 g/mol. Its IUPAC name is 10-hydrazinyl-10-oxodecanoic acid.

Molecular Properties

Compound Name10-hydrazinyl-10-oxodecanoic acid
PubChem CID175271493
Molecular FormulaC20H40N4O6
Molecular Weight432.56 g/mol
Exact Mass432.29
IUPAC Name10-hydrazinyl-10-oxodecanoic acid
SMILESNNC(=O)CCCCCCCCC(=O)O.NNC(=O)CCCCCCCCC(=O)O
InChIInChI=1S/2C10H20N2O3/c2*11-12-9(13)7-5-3-1-2-4-6-8-10(14)15/h2*1-8,11H2,(H,12,13)(H,14,15)
InChIKeyMGABPWLVFWWMRX-UHFFFAOYSA-N
XLogP2.36
TPSA184.84 Ų
H-Bond Donors6
H-Bond Acceptors6
Rotatable Bonds18
Heavy Atoms30
Complexity—

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500432.56
LogP ≤ 52.36
H-Bond Donors ≤ 56
H-Bond Acceptors ≤ 106

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}

Analyze 10-hydrazinyl-10-oxodecanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

hexanedihydrazide;pentanedihydrazide
CID 157195533
12-hydroxydodecanehydrazide
CID 12718243
tridecanedioic acid;undecanedioic acid
CID 158333715
decanedioic acid;hexanedioic acid;octanedioic acid
CID 159110511
heptadecanedioic acid
CID 3083765
decanedioic acid;hexanedioic acid;nonanedioic acid;octanedioic acid
CID 159068248
tetradecanedioic acid
CID 13185
decanedioic acid;tris(nonanedioic acid)
CID 159759294
2-aminopentanedioic acid;hexanedihydrazide
CID 175294666
triacontanedioic acid
CID 5322010
dodecanedioic acid;bis(tridecanedioic acid)
CID 87373965
decanedioic acid;icosanedioic acid
CID 161217033

Frequently Asked Questions

What is the IUPAC name of 10-hydrazinyl-10-oxodecanoic acid?
The IUPAC name of 10-hydrazinyl-10-oxodecanoic acid (CID 175271493) is 10-hydrazinyl-10-oxodecanoic acid.
What is the SMILES notation for 10-hydrazinyl-10-oxodecanoic acid?
The canonical SMILES for 10-hydrazinyl-10-oxodecanoic acid is NNC(=O)CCCCCCCCC(=O)O.NNC(=O)CCCCCCCCC(=O)O.
What is the InChIKey of 10-hydrazinyl-10-oxodecanoic acid?
The InChIKey is MGABPWLVFWWMRX-UHFFFAOYSA-N. The full InChI is InChI=1S/2C10H20N2O3/c2*11-12-9(13)7-5-3-1-2-4-6-8-10(14)15/h2*1-8,11H2,(H,12,13)(H,14,15).
What are the key properties of 10-hydrazinyl-10-oxodecanoic acid?
10-hydrazinyl-10-oxodecanoic acid has a molecular weight of 432.56 g/mol, XLogP of 2.36, 18 rotatable bonds, 6 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 10-hydrazinyl-10-oxodecanoic acid is sourced from PubChem (CID 175271493), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).