C11H26N8O4 — CID 157195533
hexanedihydrazide;pentanedihydrazide (PubChem CID 157195533) has the molecular formula C11H26N8O4 and a molecular weight of 334.38 g/mol. Its IUPAC name is hexanedihydrazide;pentanedihydrazide.
| Compound Name | hexanedihydrazide;pentanedihydrazide |
|---|---|
| PubChem CID | 157195533 |
| Molecular Formula | C11H26N8O4 |
| Molecular Weight | 334.38 g/mol |
| Exact Mass | 334.21 |
| IUPAC Name | hexanedihydrazide;pentanedihydrazide |
| SMILES | NNC(=O)CCCC(=O)NN.NNC(=O)CCCCC(=O)NN |
| InChI | InChI=1S/C6H14N4O2.C5H12N4O2/c7-9-5(11)3-1-2-4-6(12)10-8;6-8-4(10)2-1-3-5(11)9-7/h1-4,7-8H2,(H,9,11)(H,10,12);1-3,6-7H2,(H,8,10)(H,9,11) |
| InChIKey | AQEYQLROIRLNEZ-UHFFFAOYSA-N |
| XLogP | -3.34 |
| TPSA | 220.48 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.38 |
| LogP ≤ 5 | -3.34 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|