C8H15F3N2O3 — CID 161488585
hexanehydrazide;2,2,2-trifluoroacetic acid (PubChem CID 161488585) has the molecular formula C8H15F3N2O3 and a molecular weight of 244.21 g/mol. Its IUPAC name is hexanehydrazide;2,2,2-trifluoroacetic acid.
| Compound Name | hexanehydrazide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 161488585 |
| Molecular Formula | C8H15F3N2O3 |
| Molecular Weight | 244.21 g/mol |
| Exact Mass | 244.10 |
| IUPAC Name | hexanehydrazide;2,2,2-trifluoroacetic acid |
| SMILES | CCCCCC(=O)NN.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C6H14N2O.C2HF3O2/c1-2-3-4-5-6(9)8-7;3-2(4,5)1(6)7/h2-5,7H2,1H3,(H,8,9);(H,6,7) |
| InChIKey | WFHMMRHWZRBRSJ-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.21 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|