C19H36N2O — CID 150104072
nonadeca-8,12-dienehydrazide (PubChem CID 150104072) has the molecular formula C19H36N2O and a molecular weight of 308.51 g/mol. Its IUPAC name is nonadeca-8,12-dienehydrazide.
| Compound Name | nonadeca-8,12-dienehydrazide |
|---|---|
| PubChem CID | 150104072 |
| Molecular Formula | C19H36N2O |
| Molecular Weight | 308.51 g/mol |
| Exact Mass | 308.28 |
| IUPAC Name | nonadeca-8,12-dienehydrazide |
| SMILES | CCCCCCC=CCCC=CCCCCCCC(=O)NN |
| InChI | InChI=1S/C19H36N2O/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19(22)21-20/h7-8,11-12H,2-6,9-10,13-18,20H2,1H3,(H,21,22) |
| InChIKey | DVWFCLKOZOOUCF-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.51 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|