C28H51F3N4O9 — CID 25269776
[3-(4-aminobutanoyloxy)-2-(4-aminobutanoyloxymethyl)-2-(decanoylamino)propyl] 4-aminobutanoate;2,2,2-trifluoroacetic acid (PubChem CID 25269776) has the molecular formula C28H51F3N4O9 and a molecular weight of 644.73 g/mol. Its IUPAC name is [3-(4-aminobutanoyloxy)-2-(4-aminobutanoyloxymethyl)-2-(decanoylamino)propyl] 4-aminobutanoate;2,2,2-trifluoroacetic acid.
| Compound Name | [3-(4-aminobutanoyloxy)-2-(4-aminobutanoyloxymethyl)-2-(decanoylamino)propyl] 4-aminobutanoate;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 25269776 |
| Molecular Formula | C28H51F3N4O9 |
| Molecular Weight | 644.73 g/mol |
| Exact Mass | 644.36 |
| IUPAC Name | [3-(4-aminobutanoyloxy)-2-(4-aminobutanoyloxymethyl)-2-(decanoylamino)propyl] 4-aminobutanoate;2,2,2-trifluoroacetic acid |
| SMILES | CCCCCCCCCC(=O)NC(COC(=O)CCCN)(COC(=O)CCCN)COC(=O)CCCN.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C26H50N4O7.C2HF3O2/c1-2-3-4-5-6-7-8-12-22(31)30-26(19-35-23(32)13-9-16-27,20-36-24(33)14-10-17-28)21-37-25(34)15-11-18-29;3-2(4,5)1(6)7/h2-21,27-29H2,1H3,(H,30,31);(H,6,7) |
| InChIKey | RQSATRFBTGTBFP-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 223.36 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.73 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|