C23H42O6 — CID 101204578
2-methyl-3-nonanoyloxy-2-(nonanoyloxymethyl)propanoic acid (PubChem CID 101204578) has the molecular formula C23H42O6 and a molecular weight of 414.58 g/mol. Its IUPAC name is 2-methyl-3-nonanoyloxy-2-(nonanoyloxymethyl)propanoic acid.
| Compound Name | 2-methyl-3-nonanoyloxy-2-(nonanoyloxymethyl)propanoic acid |
|---|---|
| PubChem CID | 101204578 |
| Molecular Formula | C23H42O6 |
| Molecular Weight | 414.58 g/mol |
| Exact Mass | 414.30 |
| IUPAC Name | 2-methyl-3-nonanoyloxy-2-(nonanoyloxymethyl)propanoic acid |
| SMILES | CCCCCCCCC(=O)OCC(C)(COC(=O)CCCCCCCC)C(=O)O |
| InChI | InChI=1S/C23H42O6/c1-4-6-8-10-12-14-16-20(24)28-18-23(3,22(26)27)19-29-21(25)17-15-13-11-9-7-5-2/h4-19H2,1-3H3,(H,26,27) |
| InChIKey | IEARLHGMRLFQIY-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.58 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|