C26H48O5 — CID 171426049
[2,4-dimethyl-2-(nonanoyloxymethyl)-3-oxopentyl] nonanoate (PubChem CID 171426049) has the molecular formula C26H48O5 and a molecular weight of 440.67 g/mol. Its IUPAC name is [2,4-dimethyl-2-(nonanoyloxymethyl)-3-oxopentyl] nonanoate.
| Compound Name | [2,4-dimethyl-2-(nonanoyloxymethyl)-3-oxopentyl] nonanoate |
|---|---|
| PubChem CID | 171426049 |
| Molecular Formula | C26H48O5 |
| Molecular Weight | 440.67 g/mol |
| Exact Mass | 440.35 |
| IUPAC Name | [2,4-dimethyl-2-(nonanoyloxymethyl)-3-oxopentyl] nonanoate |
| SMILES | CCCCCCCCC(=O)OCC(C)(COC(=O)CCCCCCCC)C(=O)C(C)C |
| InChI | InChI=1S/C26H48O5/c1-6-8-10-12-14-16-18-23(27)30-20-26(5,25(29)22(3)4)21-31-24(28)19-17-15-13-11-9-7-2/h22H,6-21H2,1-5H3 |
| InChIKey | FIZGHMHLELBKMQ-UHFFFAOYSA-N |
| XLogP | 6.81 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.67 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|