C24H46O4 — CID 123293931
(2,2-dimethyl-3-nonanoyloxypropyl) decanoate (PubChem CID 123293931) has the molecular formula C24H46O4 and a molecular weight of 398.63 g/mol. Its IUPAC name is (2,2-dimethyl-3-nonanoyloxypropyl) decanoate.
| Compound Name | (2,2-dimethyl-3-nonanoyloxypropyl) decanoate |
|---|---|
| PubChem CID | 123293931 |
| Molecular Formula | C24H46O4 |
| Molecular Weight | 398.63 g/mol |
| Exact Mass | 398.34 |
| IUPAC Name | (2,2-dimethyl-3-nonanoyloxypropyl) decanoate |
| SMILES | CCCCCCCCCC(=O)OCC(C)(C)COC(=O)CCCCCCCC |
| InChI | InChI=1S/C24H46O4/c1-5-7-9-11-13-15-17-19-23(26)28-21-24(3,4)20-27-22(25)18-16-14-12-10-8-6-2/h5-21H2,1-4H3 |
| InChIKey | AAKUHTYVXZHZHS-UHFFFAOYSA-N |
| XLogP | 6.99 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.63 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|