C74H132O18 — CID 102060530
6-O-[2-[[6-[2,2-bis(decanoyloxymethyl)butoxy]-6-oxohexanoyl]oxymethyl]-2-(octanoyloxymethyl)butyl] 1-O-[2,2-bis(octanoyloxymethyl)butyl] hexanedioate (PubChem CID 102060530) has the molecular formula C74H132O18 and a molecular weight of 1309.85 g/mol. Its IUPAC name is 6-O-[2-[[6-[2,2-bis(decanoyloxymethyl)butoxy]-6-oxohexanoyl]oxymethyl]-2-(octanoyloxymethyl)butyl] 1-O-[2,2-bis(octanoyloxymethyl)butyl] hexanedioate.
| Compound Name | 6-O-[2-[[6-[2,2-bis(decanoyloxymethyl)butoxy]-6-oxohexanoyl]oxymethyl]-2-(octanoyloxymethyl)butyl] 1-O-[2,2-bis(octanoyloxymethyl)butyl] hexanedioate |
|---|---|
| PubChem CID | 102060530 |
| Molecular Formula | C74H132O18 |
| Molecular Weight | 1309.85 g/mol |
| Exact Mass | 1308.94 |
| IUPAC Name | 6-O-[2-[[6-[2,2-bis(decanoyloxymethyl)butoxy]-6-oxohexanoyl]oxymethyl]-2-(octanoyloxymethyl)butyl] 1-O-[2,2-bis(octanoyloxymethyl)butyl] hexanedioate |
| SMILES | CCCCCCCCCC(=O)OCC(CC)(COC(=O)CCCCCCCCC)COC(=O)CCCCC(=O)OCC(CC)(COC(=O)CCCCCCC)COC(=O)CCCCC(=O)OCC(CC)(COC(=O)CCCCCCC)COC(=O)CCCCCCC |
| InChI | InChI=1S/C74H132O18/c1-9-17-22-27-29-34-39-48-66(78)87-56-73(15-7,57-88-67(79)49-40-35-30-28-23-18-10-2)60-90-69(81)51-42-44-53-71(83)92-62-74(16-8,58-86-65(77)47-38-33-26-21-13-5)61-91-70(82)52-43-41-50-68(80)89-59-72(14-6,54-84-63(75)45-36-31-24-19-11-3)55-85-64(76)46-37-32-25-20-12-4/h9-62H2,1-8H3 |
| InChIKey | ZDXBLGIJUXMZHS-UHFFFAOYSA-N |
| XLogP | 17.55 |
| TPSA | 236.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 65 |
| Heavy Atoms | 92 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1309.85 |
| LogP ≤ 5 | 17.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 18 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|