C54H98O12 — CID 168854678
bis[2,2-bis(octanoyloxymethyl)butyl] decanedioate (PubChem CID 168854678) has the molecular formula C54H98O12 and a molecular weight of 939.37 g/mol. Its IUPAC name is bis[2,2-bis(octanoyloxymethyl)butyl] decanedioate.
| Compound Name | bis[2,2-bis(octanoyloxymethyl)butyl] decanedioate |
|---|---|
| PubChem CID | 168854678 |
| Molecular Formula | C54H98O12 |
| Molecular Weight | 939.37 g/mol |
| Exact Mass | 938.71 |
| IUPAC Name | bis[2,2-bis(octanoyloxymethyl)butyl] decanedioate |
| SMILES | CCCCCCCC(=O)OCC(CC)(COC(=O)CCCCCCC)COC(=O)CCCCCCCCC(=O)OCC(CC)(COC(=O)CCCCCCC)COC(=O)CCCCCCC |
| InChI | InChI=1S/C54H98O12/c1-7-13-17-23-29-35-47(55)61-41-53(11-5,42-62-48(56)36-30-24-18-14-8-2)45-65-51(59)39-33-27-21-22-28-34-40-52(60)66-46-54(12-6,43-63-49(57)37-31-25-19-15-9-3)44-64-50(58)38-32-26-20-16-10-4/h7-46H2,1-6H3 |
| InChIKey | UVSCEDLETGJTAH-UHFFFAOYSA-N |
| XLogP | 13.60 |
| TPSA | 157.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 47 |
| Heavy Atoms | 66 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 939.37 |
| LogP ≤ 5 | 13.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|