2,2-bis(hydroxymethyl)butyl heptanoate

C13H26O4 — CID 20545738

IUPAC2,2-bis(hydroxymethyl)butyl heptanoate
SMILESCCCCCCC(=O)OCC(CC)(CO)CO
InChIInChI=1S/C13H26O4/c1-3-5-6-7-8-12(16)17-11-13(4-2,9-14)10-15/h14-15H,3-11H2,1-2H3
InChIKeyOCELHTPLFGWCNG-UHFFFAOYSA-N
MW246.35 g/mol
LogP1.88
Rot. Bonds10

About 2,2-bis(hydroxymethyl)butyl heptanoate

2,2-bis(hydroxymethyl)butyl heptanoate (PubChem CID 20545738) has the molecular formula C13H26O4 and a molecular weight of 246.35 g/mol. Its IUPAC name is 2,2-bis(hydroxymethyl)butyl heptanoate.

Molecular Properties

Compound Name2,2-bis(hydroxymethyl)butyl heptanoate
PubChem CID20545738
Molecular FormulaC13H26O4
Molecular Weight246.35 g/mol
Exact Mass246.18
IUPAC Name2,2-bis(hydroxymethyl)butyl heptanoate
SMILESCCCCCCC(=O)OCC(CC)(CO)CO
InChIInChI=1S/C13H26O4/c1-3-5-6-7-8-12(16)17-11-13(4-2,9-14)10-15/h14-15H,3-11H2,1-2H3
InChIKeyOCELHTPLFGWCNG-UHFFFAOYSA-N
XLogP1.88
TPSA66.76 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds10
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500246.35
LogP ≤ 51.88
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze 2,2-bis(hydroxymethyl)butyl heptanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2,2-bis(hydroxymethyl)butyl heptanoate?
The IUPAC name of 2,2-bis(hydroxymethyl)butyl heptanoate (CID 20545738) is 2,2-bis(hydroxymethyl)butyl heptanoate.
What is the SMILES notation for 2,2-bis(hydroxymethyl)butyl heptanoate?
The canonical SMILES for 2,2-bis(hydroxymethyl)butyl heptanoate is CCCCCCC(=O)OCC(CC)(CO)CO.
What is the InChIKey of 2,2-bis(hydroxymethyl)butyl heptanoate?
The InChIKey is OCELHTPLFGWCNG-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H26O4/c1-3-5-6-7-8-12(16)17-11-13(4-2,9-14)10-15/h14-15H,3-11H2,1-2H3.
What are the key properties of 2,2-bis(hydroxymethyl)butyl heptanoate?
2,2-bis(hydroxymethyl)butyl heptanoate has a molecular weight of 246.35 g/mol, XLogP of 1.88, 10 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-bis(hydroxymethyl)butyl heptanoate is sourced from PubChem (CID 20545738), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).