C22H42O6 — CID 22565007
[2-(heptanoyloxymethyl)-3-hydroxy-2-(hydroxymethyl)propyl] decanoate (PubChem CID 22565007) has the molecular formula C22H42O6 and a molecular weight of 402.57 g/mol. Its IUPAC name is [2-(heptanoyloxymethyl)-3-hydroxy-2-(hydroxymethyl)propyl] decanoate.
| Compound Name | [2-(heptanoyloxymethyl)-3-hydroxy-2-(hydroxymethyl)propyl] decanoate |
|---|---|
| PubChem CID | 22565007 |
| Molecular Formula | C22H42O6 |
| Molecular Weight | 402.57 g/mol |
| Exact Mass | 402.30 |
| IUPAC Name | [2-(heptanoyloxymethyl)-3-hydroxy-2-(hydroxymethyl)propyl] decanoate |
| SMILES | CCCCCCCCCC(=O)OCC(CO)(CO)COC(=O)CCCCCC |
| InChI | InChI=1S/C22H42O6/c1-3-5-7-9-10-11-13-15-21(26)28-19-22(16-23,17-24)18-27-20(25)14-12-8-6-4-2/h23-24H,3-19H2,1-2H3 |
| InChIKey | UHQSQTIDKMDHCK-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.57 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|